C12H12F2LiNO3 — CID 129161458
lithium 2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxyacetate (PubChem CID 129161458) has the molecular formula C12H12F2LiNO3 and a molecular weight of 263.17 g/mol. Its IUPAC name is lithium 2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxyacetate.
| Compound Name | lithium 2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxyacetate |
|---|---|
| PubChem CID | 129161458 |
| Molecular Formula | C12H12F2LiNO3 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | lithium 2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxyacetate |
| SMILES | COC(C(=O)[O-])c1cccc(N2CC(F)(F)C2)c1.[Li+] |
| InChI | InChI=1S/C12H13F2NO3.Li/c1-18-10(11(16)17)8-3-2-4-9(5-8)15-6-12(13,14)7-15;/h2-5,10H,6-7H2,1H3,(H,16,17);/q;+1/p-1 |
| InChIKey | KZMJGZGVFUNTJA-UHFFFAOYSA-M |
| XLogP | -2.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |