C21H23F2N9O2S — CID 129161462
(2R)-2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 129161462) has the molecular formula C21H23F2N9O2S and a molecular weight of 503.54 g/mol. Its IUPAC name is (2R)-2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | (2R)-2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 129161462 |
| Molecular Formula | C21H23F2N9O2S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (2R)-2-[3-(3,3-difluoroazetidin-1-yl)phenyl]-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | CO[C@@H](C(=O)Nc1nnc(N[C@@H]2CCN(c3nccnn3)C2)s1)c1cccc(N2CC(F)(F)C2)c1 |
| InChI | InChI=1S/C21H23F2N9O2S/c1-34-16(13-3-2-4-15(9-13)32-11-21(22,23)12-32)17(33)27-20-30-29-19(35-20)26-14-5-8-31(10-14)18-24-6-7-25-28-18/h2-4,6-7,9,14,16H,5,8,10-12H2,1H3,(H,26,29)(H,27,30,33)/t14-,16-/m1/s1 |
| InChIKey | DXYFFQSFEMTYKX-GDBMZVCRSA-N |
| XLogP | 2.20 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |