C19H22N8O4S — CID 163479284
(2R)-2-(3-hydroxy-5-methoxyphenyl)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 163479284) has the molecular formula C19H22N8O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is (2R)-2-(3-hydroxy-5-methoxyphenyl)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | (2R)-2-(3-hydroxy-5-methoxyphenyl)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 163479284 |
| Molecular Formula | C19H22N8O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | (2R)-2-(3-hydroxy-5-methoxyphenyl)-2-methoxy-N-[5-[[(3R)-1-(1,2,4-triazin-3-yl)pyrrolidin-3-yl]amino]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1cc(O)cc([C@@H](OC)C(=O)Nc2nnc(N[C@@H]3CCN(c4nccnn4)C3)s2)c1 |
| InChI | InChI=1S/C19H22N8O4S/c1-30-14-8-11(7-13(28)9-14)15(31-2)16(29)23-19-26-25-18(32-19)22-12-3-6-27(10-12)17-20-4-5-21-24-17/h4-5,7-9,12,15,28H,3,6,10H2,1-2H3,(H,22,25)(H,23,26,29)/t12-,15-/m1/s1 |
| InChIKey | CDCZKSISTWNLNH-IUODEOHRSA-N |
| XLogP | 1.45 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |