C28H23OP — CID 129164109
9-[4-(3-dimethylphosphorylphenyl)phenyl]anthracene (PubChem CID 129164109) has the molecular formula C28H23OP and a molecular weight of 406.47 g/mol. Its IUPAC name is 9-[4-(3-dimethylphosphorylphenyl)phenyl]anthracene.
| Compound Name | 9-[4-(3-dimethylphosphorylphenyl)phenyl]anthracene |
|---|---|
| PubChem CID | 129164109 |
| Molecular Formula | C28H23OP |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 9-[4-(3-dimethylphosphorylphenyl)phenyl]anthracene |
| SMILES | CP(C)(=O)c1cccc(-c2ccc(-c3c4ccccc4cc4ccccc34)cc2)c1 |
| InChI | InChI=1S/C28H23OP/c1-30(2,29)25-11-7-10-22(19-25)20-14-16-21(17-15-20)28-26-12-5-3-8-23(26)18-24-9-4-6-13-27(24)28/h3-19H,1-2H3 |
| InChIKey | BGNPNYKPRKHAJR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|