C38H37O3P3 — CID 142477663
2,9,10-tris(3-dimethylphosphorylphenyl)anthracene (PubChem CID 142477663) has the molecular formula C38H37O3P3 and a molecular weight of 634.63 g/mol. Its IUPAC name is 2,9,10-tris(3-dimethylphosphorylphenyl)anthracene.
| Compound Name | 2,9,10-tris(3-dimethylphosphorylphenyl)anthracene |
|---|---|
| PubChem CID | 142477663 |
| Molecular Formula | C38H37O3P3 |
| Molecular Weight | 634.63 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | 2,9,10-tris(3-dimethylphosphorylphenyl)anthracene |
| SMILES | CP(C)(=O)c1cccc(-c2ccc3c(-c4cccc(P(C)(C)=O)c4)c4ccccc4c(-c4cccc(P(C)(C)=O)c4)c3c2)c1 |
| InChI | InChI=1S/C38H37O3P3/c1-42(2,39)30-15-9-12-26(22-30)27-20-21-35-36(25-27)38(29-14-11-17-32(24-29)44(5,6)41)34-19-8-7-18-33(34)37(35)28-13-10-16-31(23-28)43(3,4)40/h7-25H,1-6H3 |
| InChIKey | SLNPWOLDCKBOLZ-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.63 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|