C52H38N3OP — CID 167109598
2-[3-[3-[10-(3-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]phenyl]-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 167109598) has the molecular formula C52H38N3OP and a molecular weight of 751.87 g/mol. Its IUPAC name is 2-[3-[3-[10-(3-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]phenyl]-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-[3-[3-[10-(3-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]phenyl]-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167109598 |
| Molecular Formula | C52H38N3OP |
| Molecular Weight | 751.87 g/mol |
| Exact Mass | 751.28 |
| IUPAC Name | 2-[3-[3-[10-(3-dimethylphosphorylphenyl)anthracen-9-yl]phenyl]phenyl]-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | CP(C)(=O)c1cccc(-c2c3ccccc3c(-c3cccc(-c4cccc(-c5nc6c(-c7ccccc7)cc(-c7ccccc7)cn6n5)c4)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C52H38N3OP/c1-57(2,56)43-25-15-23-40(32-43)50-46-28-11-9-26-44(46)49(45-27-10-12-29-47(45)50)39-22-13-20-37(30-39)38-21-14-24-41(31-38)51-53-52-48(36-18-7-4-8-19-36)33-42(34-55(52)54-51)35-16-5-3-6-17-35/h3-34H,1-2H3 |
| InChIKey | IDZWOBURJNFLKP-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.87 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|