C18H12ClN3 — CID 146983620
2-chloro-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 146983620) has the molecular formula C18H12ClN3 and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-chloro-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-chloro-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 146983620 |
| Molecular Formula | C18H12ClN3 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-chloro-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Clc1nc2c(-c3ccccc3)cc(-c3ccccc3)cn2n1 |
| InChI | InChI=1S/C18H12ClN3/c19-18-20-17-16(14-9-5-2-6-10-14)11-15(12-22(17)21-18)13-7-3-1-4-8-13/h1-12H |
| InChIKey | AOUMVBHLRFETBH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |