C47H32N3OP — CID 176638737
2-[4-[3-(6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide (PubChem CID 176638737) has the molecular formula C47H32N3OP and a molecular weight of 685.77 g/mol. Its IUPAC name is 2-[4-[3-(6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide.
| Compound Name | 2-[4-[3-(6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 176638737 |
| Molecular Formula | C47H32N3OP |
| Molecular Weight | 685.77 g/mol |
| Exact Mass | 685.23 |
| IUPAC Name | 2-[4-[3-(6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide |
| SMILES | CP1(=O)c2ccccc2-c2cc(-c3ccc(-c4cccc(-c5nc6c(-c7ccccc7)cc(-c7ccccc7)cn6n5)c4)c4ccccc34)ccc21 |
| InChI | InChI=1S/C47H32N3OP/c1-52(51)44-22-11-10-21-41(44)43-28-34(23-26-45(43)52)38-25-24-37(39-19-8-9-20-40(38)39)33-17-12-18-35(27-33)46-48-47-42(32-15-6-3-7-16-32)29-36(30-50(47)49-46)31-13-4-2-5-14-31/h2-30H,1H3 |
| InChIKey | GWDVYWLTNPSYDW-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.77 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|