C51H35N2OP — CID 176638732
5-methyl-1-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide (PubChem CID 176638732) has the molecular formula C51H35N2OP and a molecular weight of 722.83 g/mol. Its IUPAC name is 5-methyl-1-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide.
| Compound Name | 5-methyl-1-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 176638732 |
| Molecular Formula | C51H35N2OP |
| Molecular Weight | 722.83 g/mol |
| Exact Mass | 722.25 |
| IUPAC Name | 5-methyl-1-[4-[4-[2-phenyl-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide |
| SMILES | CP1(=O)c2ccccc2-c2c(-c3ccc(-c4ccc(-c5cc(-c6ccc(-c7ccccc7)cc6)nc(-c6ccccc6)n5)cc4)c4ccccc34)cccc21 |
| InChI | InChI=1S/C51H35N2OP/c1-55(54)48-21-11-10-19-45(48)50-44(20-12-22-49(50)55)43-32-31-40(41-17-8-9-18-42(41)43)36-25-29-38(30-26-36)47-33-46(52-51(53-47)39-15-6-3-7-16-39)37-27-23-35(24-28-37)34-13-4-2-5-14-34/h2-33H,1H3 |
| InChIKey | DRYVDESIIGGOQJ-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.83 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|