C28H20N3OP — CID 176638517
3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylbenzo[b]phosphindole 5-oxide (PubChem CID 176638517) has the molecular formula C28H20N3OP and a molecular weight of 445.46 g/mol. Its IUPAC name is 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylbenzo[b]phosphindole 5-oxide.
| Compound Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylbenzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 176638517 |
| Molecular Formula | C28H20N3OP |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 3-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-methylbenzo[b]phosphindole 5-oxide |
| SMILES | CP1(=O)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C28H20N3OP/c1-33(32)24-15-9-8-14-22(24)23-17-16-21(18-25(23)33)28-30-26(19-10-4-2-5-11-19)29-27(31-28)20-12-6-3-7-13-20/h2-18H,1H3 |
| InChIKey | SJVKWPYGTZRNHU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|