C44H30N3OP — CID 176638574
1-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide (PubChem CID 176638574) has the molecular formula C44H30N3OP and a molecular weight of 647.72 g/mol. Its IUPAC name is 1-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide.
| Compound Name | 1-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 176638574 |
| Molecular Formula | C44H30N3OP |
| Molecular Weight | 647.72 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | 1-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]naphthalen-1-yl]-5-methylbenzo[b]phosphindole 5-oxide |
| SMILES | CP1(=O)c2ccccc2-c2c(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)c4ccccc34)cccc21 |
| InChI | InChI=1S/C44H30N3OP/c1-49(48)39-21-11-10-19-38(39)41-37(20-12-22-40(41)49)36-28-27-33(34-17-8-9-18-35(34)36)29-23-25-32(26-24-29)44-46-42(30-13-4-2-5-14-30)45-43(47-44)31-15-6-3-7-16-31/h2-28H,1H3 |
| InChIKey | UUBANHZQYURJBF-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.72 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|