C50H34N3OP — CID 176638734
5-methyl-3-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide (PubChem CID 176638734) has the molecular formula C50H34N3OP and a molecular weight of 723.82 g/mol. Its IUPAC name is 5-methyl-3-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide.
| Compound Name | 5-methyl-3-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 176638734 |
| Molecular Formula | C50H34N3OP |
| Molecular Weight | 723.82 g/mol |
| Exact Mass | 723.24 |
| IUPAC Name | 5-methyl-3-[4-[4-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]naphthalen-1-yl]benzo[b]phosphindole 5-oxide |
| SMILES | CP1(=O)c2ccccc2-c2ccc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccc(-c7ccccc7)cc6)n5)cc4)c4ccccc34)cc21 |
| InChI | InChI=1S/C50H34N3OP/c1-55(54)46-19-11-10-18-44(46)45-29-28-39(32-47(45)55)41-31-30-40(42-16-8-9-17-43(41)42)35-22-26-38(27-23-35)50-52-48(36-14-6-3-7-15-36)51-49(53-50)37-24-20-34(21-25-37)33-12-4-2-5-13-33/h2-32H,1H3 |
| InChIKey | BHIGCXFRMPCMIS-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.82 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|