C24H16BrN3 — CID 171816987
2-(3-bromophenyl)-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 171816987) has the molecular formula C24H16BrN3 and a molecular weight of 426.32 g/mol. Its IUPAC name is 2-(3-bromophenyl)-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(3-bromophenyl)-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 171816987 |
| Molecular Formula | C24H16BrN3 |
| Molecular Weight | 426.32 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-(3-bromophenyl)-6,8-diphenyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Brc1cccc(-c2nc3c(-c4ccccc4)cc(-c4ccccc4)cn3n2)c1 |
| InChI | InChI=1S/C24H16BrN3/c25-21-13-7-12-19(14-21)23-26-24-22(18-10-5-2-6-11-18)15-20(16-28(24)27-23)17-8-3-1-4-9-17/h1-16H |
| InChIKey | FYCZNZURCBSVNV-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.32 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |