C34H24NOP — CID 176638570
5-methyl-2-[4-(4-pyridin-3-ylphenyl)naphthalen-2-yl]benzo[b]phosphindole 5-oxide (PubChem CID 176638570) has the molecular formula C34H24NOP and a molecular weight of 493.55 g/mol. Its IUPAC name is 5-methyl-2-[4-(4-pyridin-3-ylphenyl)naphthalen-2-yl]benzo[b]phosphindole 5-oxide.
| Compound Name | 5-methyl-2-[4-(4-pyridin-3-ylphenyl)naphthalen-2-yl]benzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 176638570 |
| Molecular Formula | C34H24NOP |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 5-methyl-2-[4-(4-pyridin-3-ylphenyl)naphthalen-2-yl]benzo[b]phosphindole 5-oxide |
| SMILES | CP1(=O)c2ccccc2-c2cc(-c3cc(-c4ccc(-c5cccnc5)cc4)c4ccccc4c3)ccc21 |
| InChI | InChI=1S/C34H24NOP/c1-37(36)33-11-5-4-10-30(33)32-20-25(16-17-34(32)37)28-19-26-7-2-3-9-29(26)31(21-28)24-14-12-23(13-15-24)27-8-6-18-35-22-27/h2-22H,1H3 |
| InChIKey | PRJLRNMEEIMLDF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|