C16H14ClN5 — CID 82566039
2-(chloromethyl)-8-(4,5-dihydro-1H-imidazol-2-yl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 82566039) has the molecular formula C16H14ClN5 and a molecular weight of 311.78 g/mol. Its IUPAC name is 2-(chloromethyl)-8-(4,5-dihydro-1H-imidazol-2-yl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 2-(chloromethyl)-8-(4,5-dihydro-1H-imidazol-2-yl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 82566039 |
| Molecular Formula | C16H14ClN5 |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(chloromethyl)-8-(4,5-dihydro-1H-imidazol-2-yl)-6-phenyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | ClCc1nc2c(C3=NCCN3)cc(-c3ccccc3)cn2n1 |
| InChI | InChI=1S/C16H14ClN5/c17-9-14-20-16-13(15-18-6-7-19-15)8-12(10-22(16)21-14)11-4-2-1-3-5-11/h1-5,8,10H,6-7,9H2,(H,18,19) |
| InChIKey | VBIPJGUCIMCCID-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|