C23H18ClF3N6O3 — CID 129164684
N-[(2S)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-1-[cyano(cyclopropyl)amino]-1-oxopropan-2-yl]-2-phenyltriazole-4-carboxamide (PubChem CID 129164684) has the molecular formula C23H18ClF3N6O3 and a molecular weight of 518.88 g/mol. Its IUPAC name is N-[(2S)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-1-[cyano(cyclopropyl)amino]-1-oxopropan-2-yl]-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[(2S)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-1-[cyano(cyclopropyl)amino]-1-oxopropan-2-yl]-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 129164684 |
| Molecular Formula | C23H18ClF3N6O3 |
| Molecular Weight | 518.88 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | N-[(2S)-3-[3-chloro-4-(trifluoromethoxy)phenyl]-1-[cyano(cyclopropyl)amino]-1-oxopropan-2-yl]-2-phenyltriazole-4-carboxamide |
| SMILES | N#CN(C(=O)[C@H](Cc1ccc(OC(F)(F)F)c(Cl)c1)NC(=O)c1cnn(-c2ccccc2)n1)C1CC1 |
| InChI | InChI=1S/C23H18ClF3N6O3/c24-17-10-14(6-9-20(17)36-23(25,26)27)11-18(22(35)32(13-28)15-7-8-15)30-21(34)19-12-29-33(31-19)16-4-2-1-3-5-16/h1-6,9-10,12,15,18H,7-8,11H2,(H,30,34)/t18-/m0/s1 |
| InChIKey | IRNDHPCBNCDMSZ-SFHVURJKSA-N |
| XLogP | 3.63 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|