C25H24ClFN6O4 — CID 129164674
N-[(2S)-1-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-[(1-cyanocyclopropyl)amino]-3-oxopropan-2-yl]-2-(4-fluorophenyl)triazole-4-carboxamide (PubChem CID 129164674) has the molecular formula C25H24ClFN6O4 and a molecular weight of 526.96 g/mol. Its IUPAC name is N-[(2S)-1-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-[(1-cyanocyclopropyl)amino]-3-oxopropan-2-yl]-2-(4-fluorophenyl)triazole-4-carboxamide.
| Compound Name | N-[(2S)-1-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-[(1-cyanocyclopropyl)amino]-3-oxopropan-2-yl]-2-(4-fluorophenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 129164674 |
| Molecular Formula | C25H24ClFN6O4 |
| Molecular Weight | 526.96 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | N-[(2S)-1-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-[(1-cyanocyclopropyl)amino]-3-oxopropan-2-yl]-2-(4-fluorophenyl)triazole-4-carboxamide |
| SMILES | COCCOc1ccc(C[C@@](C=O)(NC(=O)c2cnn(-c3ccc(F)cc3)n2)NC2(C#N)CC2)cc1Cl |
| InChI | InChI=1S/C25H24ClFN6O4/c1-36-10-11-37-22-7-2-17(12-20(22)26)13-25(16-34,32-24(15-28)8-9-24)30-23(35)21-14-29-33(31-21)19-5-3-18(27)4-6-19/h2-7,12,14,16,32H,8-11,13H2,1H3,(H,30,35)/t25-/m1/s1 |
| InChIKey | HPIUATPCGURAEW-RUZDIDTESA-N |
| XLogP | 2.60 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.96 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|