C19H26FN3O3S — CID 129166079
6-fluoro-3-methyl-N-methylsulfonyl-1-(4-propan-2-ylcyclohexyl)indazole-5-carboxamide (PubChem CID 129166079) has the molecular formula C19H26FN3O3S and a molecular weight of 395.50 g/mol. Its IUPAC name is 6-fluoro-3-methyl-N-methylsulfonyl-1-(4-propan-2-ylcyclohexyl)indazole-5-carboxamide.
| Compound Name | 6-fluoro-3-methyl-N-methylsulfonyl-1-(4-propan-2-ylcyclohexyl)indazole-5-carboxamide |
|---|---|
| PubChem CID | 129166079 |
| Molecular Formula | C19H26FN3O3S |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 6-fluoro-3-methyl-N-methylsulfonyl-1-(4-propan-2-ylcyclohexyl)indazole-5-carboxamide |
| SMILES | Cc1nn(C2CCC(C(C)C)CC2)c2cc(F)c(C(=O)NS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C19H26FN3O3S/c1-11(2)13-5-7-14(8-6-13)23-18-10-17(20)16(9-15(18)12(3)21-23)19(24)22-27(4,25)26/h9-11,13-14H,5-8H2,1-4H3,(H,22,24) |
| InChIKey | JSUUZLDAOJRAIG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |