C17H22FN3O3S — CID 129177714
6-fluoro-3-methyl-1-(4-methylcyclohexyl)-N-methylsulfonylindazole-5-carboxamide (PubChem CID 129177714) has the molecular formula C17H22FN3O3S and a molecular weight of 367.45 g/mol. Its IUPAC name is 6-fluoro-3-methyl-1-(4-methylcyclohexyl)-N-methylsulfonylindazole-5-carboxamide.
| Compound Name | 6-fluoro-3-methyl-1-(4-methylcyclohexyl)-N-methylsulfonylindazole-5-carboxamide |
|---|---|
| PubChem CID | 129177714 |
| Molecular Formula | C17H22FN3O3S |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 6-fluoro-3-methyl-1-(4-methylcyclohexyl)-N-methylsulfonylindazole-5-carboxamide |
| SMILES | Cc1nn(C2CCC(C)CC2)c2cc(F)c(C(=O)NS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C17H22FN3O3S/c1-10-4-6-12(7-5-10)21-16-9-15(18)14(8-13(16)11(2)19-21)17(22)20-25(3,23)24/h8-10,12H,4-7H2,1-3H3,(H,20,22) |
| InChIKey | WHWZFRNBVIXXLF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |