C31H34Cl2N8O4 — CID 129167694
N-[(3R,4S)-1-(1-cyclopentylpyrazol-3-yl)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]pyrrolidin-3-yl]prop-2-enamide (PubChem CID 129167694) has the molecular formula C31H34Cl2N8O4 and a molecular weight of 653.57 g/mol. Its IUPAC name is N-[(3R,4S)-1-(1-cyclopentylpyrazol-3-yl)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]pyrrolidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-1-(1-cyclopentylpyrazol-3-yl)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]pyrrolidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 129167694 |
| Molecular Formula | C31H34Cl2N8O4 |
| Molecular Weight | 653.57 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | N-[(3R,4S)-1-(1-cyclopentylpyrazol-3-yl)-4-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]pyrrolidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CN(c2ccn(C3CCCC3)n2)C[C@@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C31H34Cl2N8O4/c1-5-25(42)35-20-15-40(24-10-11-41(38-24)18-8-6-7-9-18)16-21(20)36-31-34-14-17-12-19(30(43)39(2)29(17)37-31)26-27(32)22(44-3)13-23(45-4)28(26)33/h5,10-14,18,20-21H,1,6-9,15-16H2,2-4H3,(H,35,42)(H,34,36,37)/t20-,21+/m1/s1 |
| InChIKey | ZJOGIGXWDCUSDZ-RTWAWAEBSA-N |
| XLogP | 4.60 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|