C32H39Cl2N5O4 — CID 155110047
N-[(1S,2R)-5-cycloheptyl-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 155110047) has the molecular formula C32H39Cl2N5O4 and a molecular weight of 628.60 g/mol. Its IUPAC name is N-[(1S,2R)-5-cycloheptyl-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1S,2R)-5-cycloheptyl-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 155110047 |
| Molecular Formula | C32H39Cl2N5O4 |
| Molecular Weight | 628.60 g/mol |
| Exact Mass | 627.24 |
| IUPAC Name | N-[(1S,2R)-5-cycloheptyl-2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)-8-methyl-7-oxopyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1CC(C2CCCCCC2)CC[C@H]1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)c(=O)n(C)c2n1 |
| InChI | InChI=1S/C32H39Cl2N5O4/c1-5-26(40)36-23-15-19(18-10-8-6-7-9-11-18)12-13-22(23)37-32-35-17-20-14-21(31(41)39(2)30(20)38-32)27-28(33)24(42-3)16-25(43-4)29(27)34/h5,14,16-19,22-23H,1,6-13,15H2,2-4H3,(H,36,40)(H,35,37,38)/t19?,22-,23+/m1/s1 |
| InChIKey | KVGBTLFFAGTJDJ-XDQLBQEWSA-N |
| XLogP | 6.54 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.60 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|