C15H17ClN4O2S — CID 129172274
2-[(4-chlorocyclohexa-1,3-dien-1-yl)carbamoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 129172274) has the molecular formula C15H17ClN4O2S and a molecular weight of 352.85 g/mol. Its IUPAC name is 2-[(4-chlorocyclohexa-1,3-dien-1-yl)carbamoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-[(4-chlorocyclohexa-1,3-dien-1-yl)carbamoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129172274 |
| Molecular Formula | C15H17ClN4O2S |
| Molecular Weight | 352.85 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[(4-chlorocyclohexa-1,3-dien-1-yl)carbamoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)NC2=CC=C(Cl)CC2)sc2c1CCNC2 |
| InChI | InChI=1S/C15H17ClN4O2S/c16-8-1-3-9(4-2-8)19-15(22)20-14-12(13(17)21)10-5-6-18-7-11(10)23-14/h1,3,18H,2,4-7H2,(H2,17,21)(H2,19,20,22) |
| InChIKey | NIFKYQFCBYQUPH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.85 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |