C19H24ClN4O2S+ — CID 118307311
[3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]-trimethylazanium (PubChem CID 118307311) has the molecular formula C19H24ClN4O2S+ and a molecular weight of 407.95 g/mol. Its IUPAC name is [3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]-trimethylazanium.
| Compound Name | [3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]-trimethylazanium |
|---|---|
| PubChem CID | 118307311 |
| Molecular Formula | C19H24ClN4O2S+ |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophen-6-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C1CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3)c2C(N)=O)C1 |
| InChI | InChI=1S/C19H23ClN4O2S/c1-24(2,3)13-8-9-14-15(10-13)27-18(16(14)17(21)25)23-19(26)22-12-6-4-11(20)5-7-12/h4-7,13H,8-10H2,1-3H3,(H3-,21,22,23,25,26)/p+1 |
| InChIKey | RHUOJMYBZPNAQC-UHFFFAOYSA-O |
| XLogP | 3.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|