C19H22ClIN4O3S — CID 118307396
2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-(oxetan-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide (PubChem CID 118307396) has the molecular formula C19H22ClIN4O3S and a molecular weight of 548.83 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-(oxetan-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-(oxetan-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 118307396 |
| Molecular Formula | C19H22ClIN4O3S |
| Molecular Weight | 548.83 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-(oxetan-3-yl)-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
| SMILES | C[N+]1(C2COC2)CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3)c2C(N)=O)C1.[I-] |
| InChI | InChI=1S/C19H21ClN4O3S.HI/c1-24(13-9-27-10-13)7-6-14-15(8-24)28-18(16(14)17(21)25)23-19(26)22-12-4-2-11(20)3-5-12;/h2-5,13H,6-10H2,1H3,(H3-,21,22,23,25,26);1H |
| InChIKey | WQUHUIVNWGVWJZ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.83 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|