C22H23ClF3N4O5S+ — CID 118307304
(2,2,2-trifluoroacetyl) 4-[3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-6-yl]butanoate (PubChem CID 118307304) has the molecular formula C22H23ClF3N4O5S+ and a molecular weight of 547.96 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 4-[3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-6-yl]butanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 4-[3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-6-yl]butanoate |
|---|---|
| PubChem CID | 118307304 |
| Molecular Formula | C22H23ClF3N4O5S+ |
| Molecular Weight | 547.96 g/mol |
| Exact Mass | 547.10 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 4-[3-carbamoyl-2-[(4-chlorophenyl)carbamoylamino]-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-6-yl]butanoate |
| SMILES | C[N+]1(CCCC(=O)OC(=O)C(F)(F)F)CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3)c2C(N)=O)C1 |
| InChI | InChI=1S/C22H22ClF3N4O5S/c1-30(9-2-3-16(31)35-20(33)22(24,25)26)10-8-14-15(11-30)36-19(17(14)18(27)32)29-21(34)28-13-6-4-12(23)5-7-13/h4-7H,2-3,8-11H2,1H3,(H3-,27,28,29,32,34)/p+1 |
| InChIKey | FPESPQCMHYHDPW-UHFFFAOYSA-O |
| XLogP | 4.06 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.96 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|