C19H24ClIN4O2S — CID 118269730
2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide (PubChem CID 118269730) has the molecular formula C19H24ClIN4O2S and a molecular weight of 534.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide.
| Compound Name | 2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 118269730 |
| Molecular Formula | C19H24ClIN4O2S |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.04 |
| IUPAC Name | 2-[(4-chlorophenyl)carbamoylamino]-6-methyl-6-propan-2-yl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
| SMILES | CC(C)[N+]1(C)CCc2c(sc(NC(=O)Nc3ccc(Cl)cc3)c2C(N)=O)C1.[I-] |
| InChI | InChI=1S/C19H23ClN4O2S.HI/c1-11(2)24(3)9-8-14-15(10-24)27-18(16(14)17(21)25)23-19(26)22-13-6-4-12(20)5-7-13;/h4-7,11H,8-10H2,1-3H3,(H3-,21,22,23,25,26);1H |
| InChIKey | UMUYFEKWYCMQOY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|