C24H40ClN4O2S+ — CID 144600007
4-chloro-N-methylaniline;6,6-diethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide;ethane (PubChem CID 144600007) has the molecular formula C24H40ClN4O2S+ and a molecular weight of 484.13 g/mol. Its IUPAC name is 4-chloro-N-methylaniline;6,6-diethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide;ethane.
| Compound Name | 4-chloro-N-methylaniline;6,6-diethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide;ethane |
|---|---|
| PubChem CID | 144600007 |
| Molecular Formula | C24H40ClN4O2S+ |
| Molecular Weight | 484.13 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 4-chloro-N-methylaniline;6,6-diethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide;ethane |
| SMILES | CC.CC.CC[N+]1(CC)CCc2c(sc(NC=O)c2C(N)=O)C1.CNc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19N3O2S.C7H8ClN.2C2H6/c1-3-16(4-2)6-5-9-10(7-16)19-13(15-8-17)11(9)12(14)18;1-9-7-4-2-6(8)3-5-7;2*1-2/h8H,3-7H2,1-2H3,(H2-,14,15,17,18);2-5,9H,1H3;2*1-2H3/p+1 |
| InChIKey | SNNHKAZVZBFQDS-UHFFFAOYSA-O |
| XLogP | 5.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.13 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|