C14H20N3O2S+ — CID 144599925
6-(cyclopropylmethyl)-2-formamido-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide (PubChem CID 144599925) has the molecular formula C14H20N3O2S+ and a molecular weight of 294.40 g/mol. Its IUPAC name is 6-(cyclopropylmethyl)-2-formamido-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide.
| Compound Name | 6-(cyclopropylmethyl)-2-formamido-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide |
|---|---|
| PubChem CID | 144599925 |
| Molecular Formula | C14H20N3O2S+ |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 6-(cyclopropylmethyl)-2-formamido-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide |
| SMILES | C[N+]1(CC2CC2)CCc2c(sc(NC=O)c2C(N)=O)C1 |
| InChI | InChI=1S/C14H19N3O2S/c1-17(6-9-2-3-9)5-4-10-11(7-17)20-14(16-8-18)12(10)13(15)19/h8-9H,2-7H2,1H3,(H2-,15,16,18,19)/p+1 |
| InChIKey | CMXQYYHKAMEUQI-UHFFFAOYSA-O |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|