C22H26ClIN2O2S — CID 161116227
2-[3-(4-chlorophenyl)-2-oxopropyl]-6-(cyclopropylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide (PubChem CID 161116227) has the molecular formula C22H26ClIN2O2S and a molecular weight of 544.89 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-2-oxopropyl]-6-(cyclopropylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide.
| Compound Name | 2-[3-(4-chlorophenyl)-2-oxopropyl]-6-(cyclopropylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
|---|---|
| PubChem CID | 161116227 |
| Molecular Formula | C22H26ClIN2O2S |
| Molecular Weight | 544.89 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-2-oxopropyl]-6-(cyclopropylmethyl)-6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-ium-3-carboxamide iodide |
| SMILES | C[N+]1(CC2CC2)CCc2c(sc(CC(=O)Cc3ccc(Cl)cc3)c2C(N)=O)C1.[I-] |
| InChI | InChI=1S/C22H25ClN2O2S.HI/c1-25(12-15-2-3-15)9-8-18-20(13-25)28-19(21(18)22(24)27)11-17(26)10-14-4-6-16(23)7-5-14;/h4-7,15H,2-3,8-13H2,1H3,(H-,24,27);1H |
| InChIKey | FLNFWQQLSJWNCD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.89 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|