C12H20N4O2S — CID 144599906
6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;methanamine (PubChem CID 144599906) has the molecular formula C12H20N4O2S and a molecular weight of 284.38 g/mol. Its IUPAC name is 6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;methanamine.
| Compound Name | 6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;methanamine |
|---|---|
| PubChem CID | 144599906 |
| Molecular Formula | C12H20N4O2S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;methanamine |
| SMILES | CCN1CCc2c(sc(NC=O)c2C(N)=O)C1.CN |
| InChI | InChI=1S/C11H15N3O2S.CH5N/c1-2-14-4-3-7-8(5-14)17-11(13-6-15)9(7)10(12)16;1-2/h6H,2-5H2,1H3,(H2,12,16)(H,13,15);2H2,1H3 |
| InChIKey | AHYJHRGBYRAVJT-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|