C17H22ClN5O2S — CID 144599989
5-chloro-N-methylpyridin-3-amine;6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide (PubChem CID 144599989) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is 5-chloro-N-methylpyridin-3-amine;6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-methylpyridin-3-amine;6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144599989 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 5-chloro-N-methylpyridin-3-amine;6-ethyl-2-formamido-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CCN1CCc2c(sc(NC=O)c2C(N)=O)C1.CNc1cncc(Cl)c1 |
| InChI | InChI=1S/C11H15N3O2S.C6H7ClN2/c1-2-14-4-3-7-8(5-14)17-11(13-6-15)9(7)10(12)16;1-8-6-2-5(7)3-9-4-6/h6H,2-5H2,1H3,(H2,12,16)(H,13,15);2-4,8H,1H3 |
| InChIKey | AQGALNUHSRRVPB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|