C15H17ClN4O4S2 — CID 16813892
6-ethyl-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;hydrochloride (PubChem CID 16813892) has the molecular formula C15H17ClN4O4S2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 6-ethyl-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;hydrochloride.
| Compound Name | 6-ethyl-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 16813892 |
| Molecular Formula | C15H17ClN4O4S2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 6-ethyl-2-[(5-nitrothiophene-2-carbonyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxamide;hydrochloride |
| SMILES | CCN1CCc2c(sc(NC(=O)c3ccc([N+](=O)[O-])s3)c2C(N)=O)C1.Cl |
| InChI | InChI=1S/C15H16N4O4S2.ClH/c1-2-18-6-5-8-10(7-18)25-15(12(8)13(16)20)17-14(21)9-3-4-11(24-9)19(22)23;/h3-4H,2,5-7H2,1H3,(H2,16,20)(H,17,21);1H |
| InChIKey | DPVJEEVCYAMDHN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|