C20H17N5O5S2 — CID 86577297
2-[(5-nitrothiophene-2-carbonyl)amino]-6-N-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxamide (PubChem CID 86577297) has the molecular formula C20H17N5O5S2 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-[(5-nitrothiophene-2-carbonyl)amino]-6-N-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxamide.
| Compound Name | 2-[(5-nitrothiophene-2-carbonyl)amino]-6-N-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 86577297 |
| Molecular Formula | C20H17N5O5S2 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[(5-nitrothiophene-2-carbonyl)amino]-6-N-phenyl-5,7-dihydro-4H-thieno[2,3-c]pyridine-3,6-dicarboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2ccc([N+](=O)[O-])s2)sc2c1CCN(C(=O)Nc1ccccc1)C2 |
| InChI | InChI=1S/C20H17N5O5S2/c21-17(26)16-12-8-9-24(20(28)22-11-4-2-1-3-5-11)10-14(12)32-19(16)23-18(27)13-6-7-15(31-13)25(29)30/h1-7H,8-10H2,(H2,21,26)(H,22,28)(H,23,27) |
| InChIKey | ULEMGKBWQMSSPJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 147.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|