C16H17F4N7O3 — CID 129172327
[(3S)-3-[6-[[3-amino-5-(fluoromethoxy)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate (PubChem CID 129172327) has the molecular formula C16H17F4N7O3 and a molecular weight of 431.35 g/mol. Its IUPAC name is [(3S)-3-[6-[[3-amino-5-(fluoromethoxy)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate.
| Compound Name | [(3S)-3-[6-[[3-amino-5-(fluoromethoxy)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
|---|---|
| PubChem CID | 129172327 |
| Molecular Formula | C16H17F4N7O3 |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | [(3S)-3-[6-[[3-amino-5-(fluoromethoxy)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC(F)(F)[C@@H](C)c1nc(NC(=O)c2ncc(OCF)nc2N)ccc1F |
| InChI | InChI=1S/C16H17F4N7O3/c1-7(16(19,20)5-29-15(22)23)11-8(18)2-3-9(25-11)26-14(28)12-13(21)27-10(4-24-12)30-6-17/h2-4,7H,5-6H2,1H3,(H2,21,27)(H3,22,23)(H,25,26,28)/t7-/m0/s1 |
| InChIKey | AMXDVUWUOXFLAR-ZETCQYMHSA-N |
| XLogP | 1.80 |
| TPSA | 162.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|