C16H16F5N7O2 — CID 129172349
[(3S)-3-[6-[[3-amino-5-(difluoromethyl)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate (PubChem CID 129172349) has the molecular formula C16H16F5N7O2 and a molecular weight of 433.34 g/mol. Its IUPAC name is [(3S)-3-[6-[[3-amino-5-(difluoromethyl)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate.
| Compound Name | [(3S)-3-[6-[[3-amino-5-(difluoromethyl)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
|---|---|
| PubChem CID | 129172349 |
| Molecular Formula | C16H16F5N7O2 |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | [(3S)-3-[6-[[3-amino-5-(difluoromethyl)pyrazine-2-carbonyl]amino]-3-fluoro-2-pyridinyl]-2,2-difluorobutyl] carbamimidate |
| SMILES | [H]/N=C(\N)OCC(F)(F)[C@@H](C)c1nc(NC(=O)c2ncc(C(F)F)nc2N)ccc1F |
| InChI | InChI=1S/C16H16F5N7O2/c1-6(16(20,21)5-30-15(23)24)10-7(17)2-3-9(27-10)28-14(29)11-13(22)26-8(4-25-11)12(18)19/h2-4,6,12H,5H2,1H3,(H2,22,26)(H3,23,24)(H,27,28,29)/t6-/m0/s1 |
| InChIKey | AKFVXGCHBAADKR-LURJTMIESA-N |
| XLogP | 2.43 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|