C31H38N4O6 — CID 129172813
3-[(4aR)-8a-methoxy-1,2-dimethyl-6-oxo-1,3,4,5,7,8-hexahydroisoquinolin-4a-yl]-N-[2-[4-[(Z)-1-amino-3-nitroso-3-oxoprop-1-en-2-yl]phenyl]ethyl]-2-hydroxy-4-methylbenzamide (PubChem CID 129172813) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-[(4aR)-8a-methoxy-1,2-dimethyl-6-oxo-1,3,4,5,7,8-hexahydroisoquinolin-4a-yl]-N-[2-[4-[(Z)-1-amino-3-nitroso-3-oxoprop-1-en-2-yl]phenyl]ethyl]-2-hydroxy-4-methylbenzamide.
| Compound Name | 3-[(4aR)-8a-methoxy-1,2-dimethyl-6-oxo-1,3,4,5,7,8-hexahydroisoquinolin-4a-yl]-N-[2-[4-[(Z)-1-amino-3-nitroso-3-oxoprop-1-en-2-yl]phenyl]ethyl]-2-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 129172813 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | 3-[(4aR)-8a-methoxy-1,2-dimethyl-6-oxo-1,3,4,5,7,8-hexahydroisoquinolin-4a-yl]-N-[2-[4-[(Z)-1-amino-3-nitroso-3-oxoprop-1-en-2-yl]phenyl]ethyl]-2-hydroxy-4-methylbenzamide |
| SMILES | COC12CCC(=O)C[C@@]1(c1c(C)ccc(C(=O)NCCc3ccc(/C(=C/N)C(=O)N=O)cc3)c1O)CCN(C)C2C |
| InChI | InChI=1S/C31H38N4O6/c1-19-5-10-24(28(38)33-15-12-21-6-8-22(9-7-21)25(18-32)29(39)34-40)27(37)26(19)30-14-16-35(3)20(2)31(30,41-4)13-11-23(36)17-30/h5-10,18,20,37H,11-17,32H2,1-4H3,(H,33,38)/b25-18-/t20?,30-,31?/m1/s1 |
| InChIKey | QCGBVNMDONUQOS-BLOMANPLSA-N |
| XLogP | 3.37 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|