C14H13N3O3 — CID 129173018
N-[5-[(E)-3,3-dihydroxyprop-1-enyl]-2-pyridinyl]pyridine-3-carboxamide (PubChem CID 129173018) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is N-[5-[(E)-3,3-dihydroxyprop-1-enyl]-2-pyridinyl]pyridine-3-carboxamide.
| Compound Name | N-[5-[(E)-3,3-dihydroxyprop-1-enyl]-2-pyridinyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129173018 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | N-[5-[(E)-3,3-dihydroxyprop-1-enyl]-2-pyridinyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(/C=C/C(O)O)cn1)c1cccnc1 |
| InChI | InChI=1S/C14H13N3O3/c18-13(19)6-4-10-3-5-12(16-8-10)17-14(20)11-2-1-7-15-9-11/h1-9,13,18-19H,(H,16,17,20)/b6-4+ |
| InChIKey | PDQOUZDZVIKDCQ-GQCTYLIASA-N |
| XLogP | 1.05 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|