C31H44O7 — CID 129175850
(2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 129175850) has the molecular formula C31H44O7 and a molecular weight of 528.69 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 129175850 |
| Molecular Formula | C31H44O7 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | (2R,3R,4S,5R)-2-[[(2S,3S)-1-(3-tert-butyl-4-methylphenyl)-3-(hydroxymethyl)-7-propan-2-yloxy-1,2,3,4-tetrahydronaphthalen-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | Cc1ccc(C2c3cc(OC(C)C)ccc3C[C@H](CO)[C@H]2CO[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)cc1C(C)(C)C |
| InChI | InChI=1S/C31H44O7/c1-17(2)38-22-10-9-19-11-21(14-32)24(15-36-30-29(35)28(34)26(33)16-37-30)27(23(19)13-22)20-8-7-18(3)25(12-20)31(4,5)6/h7-10,12-13,17,21,24,26-30,32-35H,11,14-16H2,1-6H3/t21-,24-,26-,27?,28+,29-,30-/m1/s1 |
| InChIKey | JSMLEIPOCLQDTH-HPLUXFFPSA-N |
| XLogP | 3.45 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |