C22H19ClN6O2 — CID 129179536
[2-(6-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(triazol-2-yl)phenyl]methanone (PubChem CID 129179536) has the molecular formula C22H19ClN6O2 and a molecular weight of 434.89 g/mol. Its IUPAC name is [2-(6-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(triazol-2-yl)phenyl]methanone.
| Compound Name | [2-(6-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(triazol-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 129179536 |
| Molecular Formula | C22H19ClN6O2 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [2-(6-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-(triazol-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccccc1-n1nccn1)N1CC2CN(c3nc4ccc(Cl)cc4o3)CC2C1 |
| InChI | InChI=1S/C22H19ClN6O2/c23-16-5-6-18-20(9-16)31-22(26-18)28-12-14-10-27(11-15(14)13-28)21(30)17-3-1-2-4-19(17)29-24-7-8-25-29/h1-9,14-15H,10-13H2 |
| InChIKey | SYRYWTBTKAPNCU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |