C22H20ClFN6O2 — CID 129179387
[2-(5-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone (PubChem CID 129179387) has the molecular formula C22H20ClFN6O2 and a molecular weight of 454.89 g/mol. Its IUPAC name is [2-(5-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone.
| Compound Name | [2-(5-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone |
|---|---|
| PubChem CID | 129179387 |
| Molecular Formula | C22H20ClFN6O2 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [2-(5-chloro-1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[2-fluoro-6-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methanone |
| SMILES | [H]/N=C\C=N/Nc1cccc(F)c1C(=O)N1CC2CN(c3nc4cc(Cl)ccc4o3)CC2C1 |
| InChI | InChI=1S/C22H20ClFN6O2/c23-15-4-5-19-18(8-15)27-22(32-19)30-11-13-9-29(10-14(13)12-30)21(31)20-16(24)2-1-3-17(20)28-26-7-6-25/h1-8,13-14,25,28H,9-12H2/b25-6-,26-7- |
| InChIKey | MGKCWRGXCODTJB-UMULFPGASA-N |
| XLogP | 3.88 |
| TPSA | 97.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|