C23H24ClN5O2 — CID 172934793
[(2R)-5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylphenyl]methanone (PubChem CID 172934793) has the molecular formula C23H24ClN5O2 and a molecular weight of 437.93 g/mol. Its IUPAC name is [(2R)-5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylphenyl]methanone.
| Compound Name | [(2R)-5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylphenyl]methanone |
|---|---|
| PubChem CID | 172934793 |
| Molecular Formula | C23H24ClN5O2 |
| Molecular Weight | 437.93 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | [(2R)-5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylpiperidin-1-yl]-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]-5-methylphenyl]methanone |
| SMILES | [H]/N=C\C=N/Nc1ccc(C)cc1C(=O)N1CC(c2nc3cc(Cl)ccc3o2)CC[C@H]1C |
| InChI | InChI=1S/C23H24ClN5O2/c1-14-3-7-19(28-26-10-9-25)18(11-14)23(30)29-13-16(5-4-15(29)2)22-27-20-12-17(24)6-8-21(20)31-22/h3,6-12,15-16,25,28H,4-5,13H2,1-2H3/b25-9-,26-10-/t15-,16?/m1/s1 |
| InChIKey | FQUOFIXYERFFKJ-PKSHFRTISA-N |
| XLogP | 5.25 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|