C16H22N6O2 — CID 172934560
(3R,6R)-N'-hydroxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidine-3-carboximidamide (PubChem CID 172934560) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3R,6R)-N'-hydroxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidine-3-carboximidamide.
| Compound Name | (3R,6R)-N'-hydroxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 172934560 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (3R,6R)-N'-hydroxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidine-3-carboximidamide |
| SMILES | [H]/N=C\C=N/Nc1ccccc1C(=O)N1C[C@H](C(N)=NO)CC[C@H]1C |
| InChI | InChI=1S/C16H22N6O2/c1-11-6-7-12(15(18)21-24)10-22(11)16(23)13-4-2-3-5-14(13)20-19-9-8-17/h2-5,8-9,11-12,17,20,24H,6-7,10H2,1H3,(H2,18,21)/b17-8-,19-9-/t11-,12-/m1/s1 |
| InChIKey | NDXQDZAOSJQGEE-YCZDLHNLSA-N |
| XLogP | 1.72 |
| TPSA | 127.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|