C24H28N4O5 — CID 144862174
methyl 2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]oxy-6-methoxybenzoate (PubChem CID 144862174) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is methyl 2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]oxy-6-methoxybenzoate.
| Compound Name | methyl 2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]oxy-6-methoxybenzoate |
|---|---|
| PubChem CID | 144862174 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | methyl 2-[(6R)-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-6-methylpiperidin-3-yl]oxy-6-methoxybenzoate |
| SMILES | [H]/N=C/C=N\Nc1ccccc1C(=O)N1CC(Oc2cccc(OC)c2C(=O)OC)CC[C@H]1C |
| InChI | InChI=1S/C24H28N4O5/c1-16-11-12-17(33-21-10-6-9-20(31-2)22(21)24(30)32-3)15-28(16)23(29)18-7-4-5-8-19(18)27-26-14-13-25/h4-10,13-14,16-17,25,27H,11-12,15H2,1-3H3/b25-13+,26-14-/t16-,17?/m1/s1 |
| InChIKey | KMJZPUUUBNWZEU-NTDRECDYSA-N |
| XLogP | 3.60 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|