C18H24N6O2 — CID 145074205
(3R)-N'-cyclopropyloxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]piperidine-3-carboximidamide (PubChem CID 145074205) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (3R)-N'-cyclopropyloxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]piperidine-3-carboximidamide.
| Compound Name | (3R)-N'-cyclopropyloxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]piperidine-3-carboximidamide |
|---|---|
| PubChem CID | 145074205 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (3R)-N'-cyclopropyloxy-1-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]piperidine-3-carboximidamide |
| SMILES | [H]/N=C/C=N\Nc1ccccc1C(=O)N1CCC[C@@H](/C(N)=N/OC2CC2)C1 |
| InChI | InChI=1S/C18H24N6O2/c19-9-10-21-22-16-6-2-1-5-15(16)18(25)24-11-3-4-13(12-24)17(20)23-26-14-7-8-14/h1-2,5-6,9-10,13-14,19,22H,3-4,7-8,11-12H2,(H2,20,23)/b19-9+,21-10-/t13-/m1/s1 |
| InChIKey | JEOUEBVBZIGCOW-YGFGFOEHSA-N |
| XLogP | 2.04 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|