C20H30N6O2S — CID 145069748
N-[amino-[1-(2-aminobenzoyl)piperidin-3-yl]methylidene]-2-methoxy-2-methylpropanethioamide;ethane-1,2-diimine (PubChem CID 145069748) has the molecular formula C20H30N6O2S and a molecular weight of 418.57 g/mol. Its IUPAC name is N-[amino-[1-(2-aminobenzoyl)piperidin-3-yl]methylidene]-2-methoxy-2-methylpropanethioamide;ethane-1,2-diimine.
| Compound Name | N-[amino-[1-(2-aminobenzoyl)piperidin-3-yl]methylidene]-2-methoxy-2-methylpropanethioamide;ethane-1,2-diimine |
|---|---|
| PubChem CID | 145069748 |
| Molecular Formula | C20H30N6O2S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[amino-[1-(2-aminobenzoyl)piperidin-3-yl]methylidene]-2-methoxy-2-methylpropanethioamide;ethane-1,2-diimine |
| SMILES | COC(C)(C)C(=S)/N=C(\N)C1CCCN(C(=O)c2ccccc2N)C1.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C18H26N4O2S.C2H4N2/c1-18(2,24-3)17(25)21-15(20)12-7-6-10-22(11-12)16(23)13-8-4-5-9-14(13)19;3-1-2-4/h4-5,8-9,12H,6-7,10-11,19H2,1-3H3,(H2,20,21,25);1-4H/b;3-1+,4-2+ |
| InChIKey | NOHGMCHJQPRVIB-BZGZIVBQSA-N |
| XLogP | 2.52 |
| TPSA | 141.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|