About (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine
(2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine (PubChem CID 145088899) has the molecular formula C15H21N5O
and a molecular weight of 287.37 g/mol. Its IUPAC name is (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine.
Molecular Properties
| Compound Name | (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine |
| PubChem CID | 145088899 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine |
| SMILES | Nc1ccccc1C(=O)N1CC2CCC(C1)N2.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C13H17N3O.C2H4N2/c14-12-4-2-1-3-11(12)13(17)16-7-9-5-6-10(8-16)15-9;3-1-2-4/h1-4,9-10,15H,5-8,14H2;1-4H/b;3-1+,4-2+ |
| InChIKey | YTIIZSOAWMNNTD-BZGZIVBQSA-N |
| XLogP | 1.13 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine?
The IUPAC name of (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine (CID 145088899) is (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine.
What is the SMILES notation for (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine?
The canonical SMILES for (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine is Nc1ccccc1C(=O)N1CC2CCC(C1)N2.[H]/N=C/C=N/[H].
What is the InChIKey of (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine?
The InChIKey is YTIIZSOAWMNNTD-BZGZIVBQSA-N. The full InChI is InChI=1S/C13H17N3O.C2H4N2/c14-12-4-2-1-3-11(12)13(17)16-7-9-5-6-10(8-16)15-9;3-1-2-4/h1-4,9-10,15H,5-8,14H2;1-4H/b;3-1+,4-2+.
What are the key properties of (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine?
(2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine has a molecular weight of 287.37 g/mol, XLogP of 1.13, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)-(3,8-diazabicyclo[3.2.1]octan-3-yl)methanone;ethane-1,2-diimine is sourced from PubChem (CID 145088899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).