C23H25N7O2 — CID 145233995
2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one (PubChem CID 145233995) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 145233995 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[4-[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]benzoyl]-1,4-diazepan-1-yl]-5-methyl-3H-quinazolin-4-one |
| SMILES | [H]/N=C\C=N/Nc1ccccc1C(=O)N1CCCN(c2nc3cccc(C)c3c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C23H25N7O2/c1-16-6-4-9-19-20(16)21(31)27-23(26-19)30-13-5-12-29(14-15-30)22(32)17-7-2-3-8-18(17)28-25-11-10-24/h2-4,6-11,24,28H,5,12-15H2,1H3,(H,26,27,31)/b24-10-,25-11- |
| InChIKey | DOBLTRKIQAZDMK-OASZVOALSA-N |
| XLogP | 2.63 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|