C12H19N3 — CID 145229974
ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline (PubChem CID 145229974) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline.
| Compound Name | ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline |
|---|---|
| PubChem CID | 145229974 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline |
| SMILES | CC.[H]/N=C/C=N\Nc1cccc(C)c1C |
| InChI | InChI=1S/C10H13N3.C2H6/c1-8-4-3-5-10(9(8)2)13-12-7-6-11;1-2/h3-7,11,13H,1-2H3;1-2H3/b11-6+,12-7-; |
| InChIKey | NQGGKSOISPROOI-WDWSCYOBSA-N |
| XLogP | 3.38 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|