About ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline
ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline (PubChem CID 145229974) has the molecular formula C12H19N3
and a molecular weight of 205.30 g/mol. Its IUPAC name is ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline.
Molecular Properties
| Compound Name | ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline |
| PubChem CID | 145229974 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline |
| SMILES | CC.[H]/N=C/C=N\Nc1cccc(C)c1C |
| InChI | InChI=1S/C10H13N3.C2H6/c1-8-4-3-5-10(9(8)2)13-12-7-6-11;1-2/h3-7,11,13H,1-2H3;1-2H3/b11-6+,12-7-; |
| InChIKey | NQGGKSOISPROOI-WDWSCYOBSA-N |
| XLogP | 3.38 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline?
The IUPAC name of ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline (CID 145229974) is ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline.
What is the SMILES notation for ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline?
The canonical SMILES for ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline is CC.[H]/N=C/C=N\Nc1cccc(C)c1C.
What is the InChIKey of ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline?
The InChIKey is NQGGKSOISPROOI-WDWSCYOBSA-N. The full InChI is InChI=1S/C10H13N3.C2H6/c1-8-4-3-5-10(9(8)2)13-12-7-6-11;1-2/h3-7,11,13H,1-2H3;1-2H3/b11-6+,12-7-;.
What are the key properties of ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline?
ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline has a molecular weight of 205.30 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(Z)-2-iminoethylideneamino]-2,3-dimethylaniline is sourced from PubChem (CID 145229974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).