C19H20F3N7O — CID 134503503
[2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[(3R)-3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone (PubChem CID 134503503) has the molecular formula C19H20F3N7O and a molecular weight of 419.41 g/mol. Its IUPAC name is [2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[(3R)-3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone.
| Compound Name | [2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[(3R)-3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 134503503 |
| Molecular Formula | C19H20F3N7O |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | [2-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]-[(3R)-3-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone |
| SMILES | [H]/N=C/C=N\Nc1ccccc1C(=O)N1CCC[C@@H](Nc2ccc(C(F)(F)F)nn2)C1 |
| InChI | InChI=1S/C19H20F3N7O/c20-19(21,22)16-7-8-17(28-27-16)25-13-4-3-11-29(12-13)18(30)14-5-1-2-6-15(14)26-24-10-9-23/h1-2,5-10,13,23,26H,3-4,11-12H2,(H,25,28)/b23-9+,24-10-/t13-/m1/s1 |
| InChIKey | BWMWZMWKTZQBMQ-UGKURSNTSA-N |
| XLogP | 3.26 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|