C19H21F3N4O2 — CID 133432626
(4-ethoxyphenyl)-[4-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone (PubChem CID 133432626) has the molecular formula C19H21F3N4O2 and a molecular weight of 394.40 g/mol. Its IUPAC name is (4-ethoxyphenyl)-[4-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone.
| Compound Name | (4-ethoxyphenyl)-[4-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 133432626 |
| Molecular Formula | C19H21F3N4O2 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (4-ethoxyphenyl)-[4-[[6-(trifluoromethyl)pyridazin-3-yl]amino]piperidin-1-yl]methanone |
| SMILES | CCOc1ccc(C(=O)N2CCC(Nc3ccc(C(F)(F)F)nn3)CC2)cc1 |
| InChI | InChI=1S/C19H21F3N4O2/c1-2-28-15-5-3-13(4-6-15)18(27)26-11-9-14(10-12-26)23-17-8-7-16(24-25-17)19(20,21)22/h3-8,14H,2,9-12H2,1H3,(H,23,25) |
| InChIKey | JUMFIYUHPFKDRN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |